C20H28N2O4S — CID 70757809
1-[(4aR,7aS)-1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-(4-hydroxyphenyl)propan-1-one (PubChem CID 70757809) has the molecular formula C20H28N2O4S and a molecular weight of 392.52 g/mol. Its IUPAC name is 1-[(4aR,7aS)-1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-(4-hydroxyphenyl)propan-1-one.
| Compound Name | 1-[(4aR,7aS)-1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-(4-hydroxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 70757809 |
| Molecular Formula | C20H28N2O4S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 1-[(4aR,7aS)-1-(3-methylbut-2-enyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-(4-hydroxyphenyl)propan-1-one |
| SMILES | CC(C)=CCN1CCN(C(=O)CCc2ccc(O)cc2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C20H28N2O4S/c1-15(2)9-10-21-11-12-22(19-14-27(25,26)13-18(19)21)20(24)8-5-16-3-6-17(23)7-4-16/h3-4,6-7,9,18-19,23H,5,8,10-14H2,1-2H3/t18-,19+/m1/s1 |
| InChIKey | NVJNQSMKYDWSRW-MOPGFXCFSA-N |
| XLogP | 1.60 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|