C18H24N2O5S — CID 133128233
1-[(4aS,7aR)-1-acetyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-(4-methoxyphenyl)propan-1-one (PubChem CID 133128233) has the molecular formula C18H24N2O5S and a molecular weight of 380.47 g/mol. Its IUPAC name is 1-[(4aS,7aR)-1-acetyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-(4-methoxyphenyl)propan-1-one.
| Compound Name | 1-[(4aS,7aR)-1-acetyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-(4-methoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 133128233 |
| Molecular Formula | C18H24N2O5S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 1-[(4aS,7aR)-1-acetyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-(4-methoxyphenyl)propan-1-one |
| SMILES | COc1ccc(CCC(=O)N2CCN(C(C)=O)[C@H]3CS(=O)(=O)C[C@H]32)cc1 |
| InChI | InChI=1S/C18H24N2O5S/c1-13(21)19-9-10-20(17-12-26(23,24)11-16(17)19)18(22)8-5-14-3-6-15(25-2)7-4-14/h3-4,6-7,16-17H,5,8-12H2,1-2H3/t16-,17+/m0/s1 |
| InChIKey | XWPKZOQBWRHRQX-DLBZAZTESA-N |
| XLogP | 0.48 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |