C21H24N2O4S — CID 70710165
1-[(4aS,7aR)-6,6-dioxo-1-[(4-phenoxyphenyl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]ethanone (PubChem CID 70710165) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is 1-[(4aS,7aR)-6,6-dioxo-1-[(4-phenoxyphenyl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]ethanone.
| Compound Name | 1-[(4aS,7aR)-6,6-dioxo-1-[(4-phenoxyphenyl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]ethanone |
|---|---|
| PubChem CID | 70710165 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 1-[(4aS,7aR)-6,6-dioxo-1-[(4-phenoxyphenyl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]ethanone |
| SMILES | CC(=O)N1CCN(Cc2ccc(Oc3ccccc3)cc2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C21H24N2O4S/c1-16(24)23-12-11-22(20-14-28(25,26)15-21(20)23)13-17-7-9-19(10-8-17)27-18-5-3-2-4-6-18/h2-10,20-21H,11-15H2,1H3/t20-,21+/m0/s1 |
| InChIKey | LEDFGNLALSUSHY-LEWJYISDSA-N |
| XLogP | 2.31 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |