C17H23N3O5S — CID 70737071
2-[3-[[(4aS,7aR)-4-acetyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]methyl]phenoxy]acetamide (PubChem CID 70737071) has the molecular formula C17H23N3O5S and a molecular weight of 381.45 g/mol. Its IUPAC name is 2-[3-[[(4aS,7aR)-4-acetyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]methyl]phenoxy]acetamide.
| Compound Name | 2-[3-[[(4aS,7aR)-4-acetyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 70737071 |
| Molecular Formula | C17H23N3O5S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 2-[3-[[(4aS,7aR)-4-acetyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]methyl]phenoxy]acetamide |
| SMILES | CC(=O)N1CCN(Cc2cccc(OCC(N)=O)c2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C17H23N3O5S/c1-12(21)20-6-5-19(15-10-26(23,24)11-16(15)20)8-13-3-2-4-14(7-13)25-9-17(18)22/h2-4,7,15-16H,5-6,8-11H2,1H3,(H2,18,22)/t15-,16+/m0/s1 |
| InChIKey | HNGUNDSSOPYASF-JKSUJKDBSA-N |
| XLogP | -0.62 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |