C16H21FN2O3S — CID 70757336
1-[(4aS,7aR)-1-[(3-fluoro-5-methylphenyl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]ethanone (PubChem CID 70757336) has the molecular formula C16H21FN2O3S and a molecular weight of 340.42 g/mol. Its IUPAC name is 1-[(4aS,7aR)-1-[(3-fluoro-5-methylphenyl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]ethanone.
| Compound Name | 1-[(4aS,7aR)-1-[(3-fluoro-5-methylphenyl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]ethanone |
|---|---|
| PubChem CID | 70757336 |
| Molecular Formula | C16H21FN2O3S |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 1-[(4aS,7aR)-1-[(3-fluoro-5-methylphenyl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]ethanone |
| SMILES | CC(=O)N1CCN(Cc2cc(C)cc(F)c2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C16H21FN2O3S/c1-11-5-13(7-14(17)6-11)8-18-3-4-19(12(2)20)16-10-23(21,22)9-15(16)18/h5-7,15-16H,3-4,8-10H2,1-2H3/t15-,16+/m0/s1 |
| InChIKey | IHPVXODDUMTIMZ-JKSUJKDBSA-N |
| XLogP | 0.96 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |