C15H19FN2O4S — CID 133126235
2-[(4aR,7aS)-1-[(3-fluorophenyl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]acetic acid (PubChem CID 133126235) has the molecular formula C15H19FN2O4S and a molecular weight of 342.39 g/mol. Its IUPAC name is 2-[(4aR,7aS)-1-[(3-fluorophenyl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]acetic acid.
| Compound Name | 2-[(4aR,7aS)-1-[(3-fluorophenyl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]acetic acid |
|---|---|
| PubChem CID | 133126235 |
| Molecular Formula | C15H19FN2O4S |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 2-[(4aR,7aS)-1-[(3-fluorophenyl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(Cc2cccc(F)c2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C15H19FN2O4S/c16-12-3-1-2-11(6-12)7-17-4-5-18(8-15(19)20)14-10-23(21,22)9-13(14)17/h1-3,6,13-14H,4-5,7-10H2,(H,19,20)/t13-,14+/m1/s1 |
| InChIKey | MZEBFEMLEQPZMZ-KGLIPLIRSA-N |
| XLogP | 0.19 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |