C17H25N3O4S — CID 70737229
2-[(4aS,7aR)-1-[[3-(2-aminoethyl)phenyl]methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]acetic acid (PubChem CID 70737229) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is 2-[(4aS,7aR)-1-[[3-(2-aminoethyl)phenyl]methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]acetic acid.
| Compound Name | 2-[(4aS,7aR)-1-[[3-(2-aminoethyl)phenyl]methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]acetic acid |
|---|---|
| PubChem CID | 70737229 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 2-[(4aS,7aR)-1-[[3-(2-aminoethyl)phenyl]methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]acetic acid |
| SMILES | NCCc1cccc(CN2CCN(CC(=O)O)[C@@H]3CS(=O)(=O)C[C@@H]32)c1 |
| InChI | InChI=1S/C17H25N3O4S/c18-5-4-13-2-1-3-14(8-13)9-19-6-7-20(10-17(21)22)16-12-25(23,24)11-15(16)19/h1-3,8,15-16H,4-7,9-12,18H2,(H,21,22)/t15-,16+/m0/s1 |
| InChIKey | DRKTZEIAKGWUIA-JKSUJKDBSA-N |
| XLogP | -0.44 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |