2-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]acetic acid

C14H19FN2O2 — CID 62824164

IUPAC2-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]acetic acid
SMILESO=C(O)CN1CCCN(Cc2cccc(F)c2)CC1
InChIInChI=1S/C14H19FN2O2/c15-13-4-1-3-12(9-13)10-16-5-2-6-17(8-7-16)11-14(18)19/h1,3-4,9H,2,5-8,10-11H2,(H,18,19)
InChIKeyNURNFSHYFDPJIG-UHFFFAOYSA-N
MW266.32 g/mol
LogP1.42
Rot. Bonds4

About 2-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]acetic acid

2-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]acetic acid (PubChem CID 62824164) has the molecular formula C14H19FN2O2 and a molecular weight of 266.32 g/mol. Its IUPAC name is 2-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]acetic acid.

Molecular Properties

Compound Name2-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]acetic acid
PubChem CID62824164
Molecular FormulaC14H19FN2O2
Molecular Weight266.32 g/mol
Exact Mass266.14
IUPAC Name2-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]acetic acid
SMILESO=C(O)CN1CCCN(Cc2cccc(F)c2)CC1
InChIInChI=1S/C14H19FN2O2/c15-13-4-1-3-12(9-13)10-16-5-2-6-17(8-7-16)11-14(18)19/h1,3-4,9H,2,5-8,10-11H2,(H,18,19)
InChIKeyNURNFSHYFDPJIG-UHFFFAOYSA-N
XLogP1.42
TPSA43.78 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.32
LogP ≤ 51.42
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]acetic acid?
The IUPAC name of 2-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]acetic acid (CID 62824164) is 2-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]acetic acid.
What is the SMILES notation for 2-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]acetic acid?
The canonical SMILES for 2-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]acetic acid is O=C(O)CN1CCCN(Cc2cccc(F)c2)CC1.
What is the InChIKey of 2-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]acetic acid?
The InChIKey is NURNFSHYFDPJIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19FN2O2/c15-13-4-1-3-12(9-13)10-16-5-2-6-17(8-7-16)11-14(18)19/h1,3-4,9H,2,5-8,10-11H2,(H,18,19).
What are the key properties of 2-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]acetic acid?
2-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]acetic acid has a molecular weight of 266.32 g/mol, XLogP of 1.42, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(3-fluorophenyl)methyl]-1,4-diazepan-1-yl]acetic acid is sourced from PubChem (CID 62824164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).