C22H32N4O8 — CID 87689236
3-[[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]methyl]benzoic acid (PubChem CID 87689236) has the molecular formula C22H32N4O8 and a molecular weight of 480.52 g/mol. Its IUPAC name is 3-[[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 87689236 |
| Molecular Formula | C22H32N4O8 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 3-[[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]methyl]benzoic acid |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CCN(Cc2cccc(C(=O)O)c2)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C22H32N4O8/c27-19(28)14-24-6-4-23(13-17-2-1-3-18(12-17)22(33)34)5-7-25(15-20(29)30)9-11-26(10-8-24)16-21(31)32/h1-3,12H,4-11,13-16H2,(H,27,28)(H,29,30)(H,31,32)(H,33,34) |
| InChIKey | NKJBULWNCGIPRQ-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 162.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |