C14H18F2N2O2 — CID 65061399
2-[4-[(3,4-difluorophenyl)methyl]-1,4-diazepan-1-yl]acetic acid (PubChem CID 65061399) has the molecular formula C14H18F2N2O2 and a molecular weight of 284.31 g/mol. Its IUPAC name is 2-[4-[(3,4-difluorophenyl)methyl]-1,4-diazepan-1-yl]acetic acid.
| Compound Name | 2-[4-[(3,4-difluorophenyl)methyl]-1,4-diazepan-1-yl]acetic acid |
|---|---|
| PubChem CID | 65061399 |
| Molecular Formula | C14H18F2N2O2 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-[4-[(3,4-difluorophenyl)methyl]-1,4-diazepan-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCCN(Cc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C14H18F2N2O2/c15-12-3-2-11(8-13(12)16)9-17-4-1-5-18(7-6-17)10-14(19)20/h2-3,8H,1,4-7,9-10H2,(H,19,20) |
| InChIKey | WGVXFLASRNQQBC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |