C14H19F2NO2 — CID 56886709
1-[(3,4-difluorophenyl)methyl]-4-(hydroxymethyl)azepan-4-ol (PubChem CID 56886709) has the molecular formula C14H19F2NO2 and a molecular weight of 271.31 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-4-(hydroxymethyl)azepan-4-ol.
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-4-(hydroxymethyl)azepan-4-ol |
|---|---|
| PubChem CID | 56886709 |
| Molecular Formula | C14H19F2NO2 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-4-(hydroxymethyl)azepan-4-ol |
| SMILES | OCC1(O)CCCN(Cc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C14H19F2NO2/c15-12-3-2-11(8-13(12)16)9-17-6-1-4-14(19,10-18)5-7-17/h2-3,8,18-19H,1,4-7,9-10H2 |
| InChIKey | HQAYHBQYEFQQKI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |