C20H30N2O2 — CID 95290603
1-[(2S)-2-[(2S)-1-ethylpyrrolidin-2-yl]pyrrolidin-1-yl]-3-(4-methoxyphenyl)propan-1-one (PubChem CID 95290603) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is 1-[(2S)-2-[(2S)-1-ethylpyrrolidin-2-yl]pyrrolidin-1-yl]-3-(4-methoxyphenyl)propan-1-one.
| Compound Name | 1-[(2S)-2-[(2S)-1-ethylpyrrolidin-2-yl]pyrrolidin-1-yl]-3-(4-methoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 95290603 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 1-[(2S)-2-[(2S)-1-ethylpyrrolidin-2-yl]pyrrolidin-1-yl]-3-(4-methoxyphenyl)propan-1-one |
| SMILES | CCN1CCC[C@H]1[C@@H]1CCCN1C(=O)CCc1ccc(OC)cc1 |
| InChI | InChI=1S/C20H30N2O2/c1-3-21-14-4-6-18(21)19-7-5-15-22(19)20(23)13-10-16-8-11-17(24-2)12-9-16/h8-9,11-12,18-19H,3-7,10,13-15H2,1-2H3/t18-,19-/m0/s1 |
| InChIKey | NMTCEHCHIVTCRY-OALUTQOASA-N |
| XLogP | 3.10 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |