C15H28FN3O3S — CID 70730760
2-[(4aS,7aR)-1-(5-fluoropentyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-N,N-dimethylacetamide (PubChem CID 70730760) has the molecular formula C15H28FN3O3S and a molecular weight of 349.47 g/mol. Its IUPAC name is 2-[(4aS,7aR)-1-(5-fluoropentyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[(4aS,7aR)-1-(5-fluoropentyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 70730760 |
| Molecular Formula | C15H28FN3O3S |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 2-[(4aS,7aR)-1-(5-fluoropentyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN1CCN(CCCCCF)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C15H28FN3O3S/c1-17(2)15(20)10-19-9-8-18(7-5-3-4-6-16)13-11-23(21,22)12-14(13)19/h13-14H,3-12H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | RRBURCGHBFFJDD-UONOGXRCSA-N |
| XLogP | -0.00 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|