C15H27N3O5S — CID 133120050
2-[(4aS,7aR)-4-(3-ethoxypropanoyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-N,N-dimethylacetamide (PubChem CID 133120050) has the molecular formula C15H27N3O5S and a molecular weight of 361.46 g/mol. Its IUPAC name is 2-[(4aS,7aR)-4-(3-ethoxypropanoyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[(4aS,7aR)-4-(3-ethoxypropanoyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 133120050 |
| Molecular Formula | C15H27N3O5S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 2-[(4aS,7aR)-4-(3-ethoxypropanoyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-N,N-dimethylacetamide |
| SMILES | CCOCCC(=O)N1CCN(CC(=O)N(C)C)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C15H27N3O5S/c1-4-23-8-5-14(19)18-7-6-17(9-15(20)16(2)3)12-10-24(21,22)11-13(12)18/h12-13H,4-11H2,1-3H3/t12-,13+/m0/s1 |
| InChIKey | RGUFSYVELAMGAD-QWHCGFSZSA-N |
| XLogP | -1.19 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|