C16H30N4O5S — CID 70782951
2-[(4aR,7aS)-4-[2-[2-methoxyethyl(methyl)amino]acetyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-N,N-dimethylacetamide (PubChem CID 70782951) has the molecular formula C16H30N4O5S and a molecular weight of 390.51 g/mol. Its IUPAC name is 2-[(4aR,7aS)-4-[2-[2-methoxyethyl(methyl)amino]acetyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[(4aR,7aS)-4-[2-[2-methoxyethyl(methyl)amino]acetyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 70782951 |
| Molecular Formula | C16H30N4O5S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 2-[(4aR,7aS)-4-[2-[2-methoxyethyl(methyl)amino]acetyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]-N,N-dimethylacetamide |
| SMILES | COCCN(C)CC(=O)N1CCN(CC(=O)N(C)C)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C16H30N4O5S/c1-17(2)15(21)10-19-5-6-20(14-12-26(23,24)11-13(14)19)16(22)9-18(3)7-8-25-4/h13-14H,5-12H2,1-4H3/t13-,14+/m1/s1 |
| InChIKey | VLMQKGDMQZRVRN-KGLIPLIRSA-N |
| XLogP | -2.04 |
| TPSA | 90.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |