C16H29N3O4S — CID 78087862
2-[1-(2-methoxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-1-piperidin-1-ylethanone (PubChem CID 78087862) has the molecular formula C16H29N3O4S and a molecular weight of 359.49 g/mol. Its IUPAC name is 2-[1-(2-methoxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-1-piperidin-1-ylethanone.
| Compound Name | 2-[1-(2-methoxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 78087862 |
| Molecular Formula | C16H29N3O4S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 2-[1-(2-methoxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-1-piperidin-1-ylethanone |
| SMILES | COCCN1CCN(CC(=O)N2CCCCC2)C2CS(=O)(=O)CC21 |
| InChI | InChI=1S/C16H29N3O4S/c1-23-10-9-17-7-8-19(15-13-24(21,22)12-14(15)17)11-16(20)18-5-3-2-4-6-18/h14-15H,2-13H2,1H3 |
| InChIKey | JFGXYROSTNRHPN-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |