C16H20F2N2O4S — CID 70781204
[(4aR,7aS)-1-(2-methoxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(3,4-difluorophenyl)methanone (PubChem CID 70781204) has the molecular formula C16H20F2N2O4S and a molecular weight of 374.41 g/mol. Its IUPAC name is [(4aR,7aS)-1-(2-methoxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(3,4-difluorophenyl)methanone.
| Compound Name | [(4aR,7aS)-1-(2-methoxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(3,4-difluorophenyl)methanone |
|---|---|
| PubChem CID | 70781204 |
| Molecular Formula | C16H20F2N2O4S |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | [(4aR,7aS)-1-(2-methoxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(3,4-difluorophenyl)methanone |
| SMILES | COCCN1CCN(C(=O)c2ccc(F)c(F)c2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C16H20F2N2O4S/c1-24-7-6-19-4-5-20(15-10-25(22,23)9-14(15)19)16(21)11-2-3-12(17)13(18)8-11/h2-3,8,14-15H,4-7,9-10H2,1H3/t14-,15+/m1/s1 |
| InChIKey | OQVVTCHVXAOHMR-CABCVRRESA-N |
| XLogP | 0.53 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |