C17H22F2N2O3S — CID 70709895
[(4aR,7aS)-1-butyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(2,5-difluorophenyl)methanone (PubChem CID 70709895) has the molecular formula C17H22F2N2O3S and a molecular weight of 372.44 g/mol. Its IUPAC name is [(4aR,7aS)-1-butyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(2,5-difluorophenyl)methanone.
| Compound Name | [(4aR,7aS)-1-butyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(2,5-difluorophenyl)methanone |
|---|---|
| PubChem CID | 70709895 |
| Molecular Formula | C17H22F2N2O3S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | [(4aR,7aS)-1-butyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(2,5-difluorophenyl)methanone |
| SMILES | CCCCN1CCN(C(=O)c2cc(F)ccc2F)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C17H22F2N2O3S/c1-2-3-6-20-7-8-21(16-11-25(23,24)10-15(16)20)17(22)13-9-12(18)4-5-14(13)19/h4-5,9,15-16H,2-3,6-8,10-11H2,1H3/t15-,16+/m1/s1 |
| InChIKey | LWBXVYOEQNVPJJ-CVEARBPZSA-N |
| XLogP | 1.69 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |