C15H18ClFN2O4S — CID 133131741
[(4aS,7aR)-1-(2-hydroxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(2-chloro-4-fluorophenyl)methanone (PubChem CID 133131741) has the molecular formula C15H18ClFN2O4S and a molecular weight of 376.84 g/mol. Its IUPAC name is [(4aS,7aR)-1-(2-hydroxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(2-chloro-4-fluorophenyl)methanone.
| Compound Name | [(4aS,7aR)-1-(2-hydroxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(2-chloro-4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 133131741 |
| Molecular Formula | C15H18ClFN2O4S |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | [(4aS,7aR)-1-(2-hydroxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(2-chloro-4-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1Cl)N1CCN(CCO)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C15H18ClFN2O4S/c16-12-7-10(17)1-2-11(12)15(21)19-4-3-18(5-6-20)13-8-24(22,23)9-14(13)19/h1-2,7,13-14,20H,3-6,8-9H2/t13-,14+/m0/s1 |
| InChIKey | WHMBMIYRMNGGGJ-UONOGXRCSA-N |
| XLogP | 0.39 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |