C12H13ClFNO3 — CID 97040195
(2-chloro-4-fluorophenyl)-[(3R)-3-(hydroxymethyl)morpholin-4-yl]methanone (PubChem CID 97040195) has the molecular formula C12H13ClFNO3 and a molecular weight of 273.69 g/mol. Its IUPAC name is (2-chloro-4-fluorophenyl)-[(3R)-3-(hydroxymethyl)morpholin-4-yl]methanone.
| Compound Name | (2-chloro-4-fluorophenyl)-[(3R)-3-(hydroxymethyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 97040195 |
| Molecular Formula | C12H13ClFNO3 |
| Molecular Weight | 273.69 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | (2-chloro-4-fluorophenyl)-[(3R)-3-(hydroxymethyl)morpholin-4-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1Cl)N1CCOC[C@H]1CO |
| InChI | InChI=1S/C12H13ClFNO3/c13-11-5-8(14)1-2-10(11)12(17)15-3-4-18-7-9(15)6-16/h1-2,5,9,16H,3-4,6-7H2/t9-/m1/s1 |
| InChIKey | ODSZKXRDNOXTCQ-SECBINFHSA-N |
| XLogP | 1.31 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.69 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |