C12H13Br2NO3 — CID 114373014
(2,5-dibromophenyl)-[3-(hydroxymethyl)morpholin-4-yl]methanone (PubChem CID 114373014) has the molecular formula C12H13Br2NO3 and a molecular weight of 379.05 g/mol. Its IUPAC name is (2,5-dibromophenyl)-[3-(hydroxymethyl)morpholin-4-yl]methanone.
| Compound Name | (2,5-dibromophenyl)-[3-(hydroxymethyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 114373014 |
| Molecular Formula | C12H13Br2NO3 |
| Molecular Weight | 379.05 g/mol |
| Exact Mass | 376.93 |
| IUPAC Name | (2,5-dibromophenyl)-[3-(hydroxymethyl)morpholin-4-yl]methanone |
| SMILES | O=C(c1cc(Br)ccc1Br)N1CCOCC1CO |
| InChI | InChI=1S/C12H13Br2NO3/c13-8-1-2-11(14)10(5-8)12(17)15-3-4-18-7-9(15)6-16/h1-2,5,9,16H,3-4,6-7H2 |
| InChIKey | NAZHZHLWNUNWFE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.05 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |