C19H27N3O4S — CID 156606088
[1-(2-methoxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(5,6,7,8-tetrahydroquinolin-3-yl)methanone (PubChem CID 156606088) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is [1-(2-methoxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(5,6,7,8-tetrahydroquinolin-3-yl)methanone.
| Compound Name | [1-(2-methoxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(5,6,7,8-tetrahydroquinolin-3-yl)methanone |
|---|---|
| PubChem CID | 156606088 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | [1-(2-methoxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(5,6,7,8-tetrahydroquinolin-3-yl)methanone |
| SMILES | COCCN1CCN(C(=O)c2cnc3c(c2)CCCC3)C2CS(=O)(=O)CC21 |
| InChI | InChI=1S/C19H27N3O4S/c1-26-9-8-21-6-7-22(18-13-27(24,25)12-17(18)21)19(23)15-10-14-4-2-3-5-16(14)20-11-15/h10-11,17-18H,2-9,12-13H2,1H3 |
| InChIKey | VRVMPDKTJRBSEY-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |