C14H19ClN2O4S2 — CID 133123169
[(4aS,7aR)-1-(2-methoxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(5-chlorothiophen-2-yl)methanone (PubChem CID 133123169) has the molecular formula C14H19ClN2O4S2 and a molecular weight of 378.90 g/mol. Its IUPAC name is [(4aS,7aR)-1-(2-methoxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(5-chlorothiophen-2-yl)methanone.
| Compound Name | [(4aS,7aR)-1-(2-methoxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(5-chlorothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 133123169 |
| Molecular Formula | C14H19ClN2O4S2 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | [(4aS,7aR)-1-(2-methoxyethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(5-chlorothiophen-2-yl)methanone |
| SMILES | COCCN1CCN(C(=O)c2ccc(Cl)s2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C14H19ClN2O4S2/c1-21-7-6-16-4-5-17(11-9-23(19,20)8-10(11)16)14(18)12-2-3-13(15)22-12/h2-3,10-11H,4-9H2,1H3/t10-,11+/m0/s1 |
| InChIKey | GMLATJTWCJXBGE-WDEREUQCSA-N |
| XLogP | 0.97 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |