C14H21ClN2O3S2 — CID 133134396
(4aS,7aR)-4-[(5-chlorothiophen-2-yl)methyl]-1-(2-methoxyethyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 133134396) has the molecular formula C14H21ClN2O3S2 and a molecular weight of 364.92 g/mol. Its IUPAC name is (4aS,7aR)-4-[(5-chlorothiophen-2-yl)methyl]-1-(2-methoxyethyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aS,7aR)-4-[(5-chlorothiophen-2-yl)methyl]-1-(2-methoxyethyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 133134396 |
| Molecular Formula | C14H21ClN2O3S2 |
| Molecular Weight | 364.92 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | (4aS,7aR)-4-[(5-chlorothiophen-2-yl)methyl]-1-(2-methoxyethyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | COCCN1CCN(Cc2ccc(Cl)s2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C14H21ClN2O3S2/c1-20-7-6-16-4-5-17(8-11-2-3-14(15)21-11)13-10-22(18,19)9-12(13)16/h2-3,12-13H,4-10H2,1H3/t12-,13+/m0/s1 |
| InChIKey | PCUSRLZXCHOFJI-QWHCGFSZSA-N |
| XLogP | 1.33 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.92 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |