C17H27N3O2S2 — CID 133131123
(4aS,7aR)-1-methyl-4-[[5-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 133131123) has the molecular formula C17H27N3O2S2 and a molecular weight of 369.56 g/mol. Its IUPAC name is (4aS,7aR)-1-methyl-4-[[5-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aS,7aR)-1-methyl-4-[[5-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 133131123 |
| Molecular Formula | C17H27N3O2S2 |
| Molecular Weight | 369.56 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | (4aS,7aR)-1-methyl-4-[[5-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | CN1CCN(Cc2ccc(CN3CCCC3)s2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C17H27N3O2S2/c1-18-8-9-20(17-13-24(21,22)12-16(17)18)11-15-5-4-14(23-15)10-19-6-2-3-7-19/h4-5,16-17H,2-3,6-13H2,1H3/t16-,17+/m0/s1 |
| InChIKey | XMQKFUQYYDGNIB-DLBZAZTESA-N |
| XLogP | 1.26 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.56 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |