C18H26N4O2S2 — CID 133111971
(4aR,7aS)-4-(2-methylpropyl)-1-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 133111971) has the molecular formula C18H26N4O2S2 and a molecular weight of 394.57 g/mol. Its IUPAC name is (4aR,7aS)-4-(2-methylpropyl)-1-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aR,7aS)-4-(2-methylpropyl)-1-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 133111971 |
| Molecular Formula | C18H26N4O2S2 |
| Molecular Weight | 394.57 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | (4aR,7aS)-4-(2-methylpropyl)-1-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | CC(C)CN1CCN(Cc2ccc(-c3ccn[nH]3)s2)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C18H26N4O2S2/c1-13(2)9-21-7-8-22(17-12-26(23,24)11-16(17)21)10-14-3-4-18(25-14)15-5-6-19-20-15/h3-6,13,16-17H,7-12H2,1-2H3,(H,19,20)/t16-,17+/m0/s1 |
| InChIKey | OZAODLSXPPPYBU-DLBZAZTESA-N |
| XLogP | 2.08 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.57 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |