C17H24N4S2 — CID 77086729
1-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl]-4-(thian-4-yl)piperazine (PubChem CID 77086729) has the molecular formula C17H24N4S2 and a molecular weight of 348.54 g/mol. Its IUPAC name is 1-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl]-4-(thian-4-yl)piperazine.
| Compound Name | 1-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl]-4-(thian-4-yl)piperazine |
|---|---|
| PubChem CID | 77086729 |
| Molecular Formula | C17H24N4S2 |
| Molecular Weight | 348.54 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl]-4-(thian-4-yl)piperazine |
| SMILES | c1cc(-c2ccc(CN3CCN(C4CCSCC4)CC3)s2)[nH]n1 |
| InChI | InChI=1S/C17H24N4S2/c1-2-17(16-3-6-18-19-16)23-15(1)13-20-7-9-21(10-8-20)14-4-11-22-12-5-14/h1-3,6,14H,4-5,7-13H2,(H,18,19) |
| InChIKey | PAEMDWFFVPSGSE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.54 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |