C18H20N4OS — CID 91767079
2-[4-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl]piperazin-1-yl]phenol (PubChem CID 91767079) has the molecular formula C18H20N4OS and a molecular weight of 340.45 g/mol. Its IUPAC name is 2-[4-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl]piperazin-1-yl]phenol.
| Compound Name | 2-[4-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl]piperazin-1-yl]phenol |
|---|---|
| PubChem CID | 91767079 |
| Molecular Formula | C18H20N4OS |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 2-[4-[[5-(1H-pyrazol-5-yl)thiophen-2-yl]methyl]piperazin-1-yl]phenol |
| SMILES | Oc1ccccc1N1CCN(Cc2ccc(-c3ccn[nH]3)s2)CC1 |
| InChI | InChI=1S/C18H20N4OS/c23-17-4-2-1-3-16(17)22-11-9-21(10-12-22)13-14-5-6-18(24-14)15-7-8-19-20-15/h1-8,23H,9-13H2,(H,19,20) |
| InChIKey | AGZLDBZEBXADBV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 55.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |