C15H26N4S — CID 91839725
1-[2-(5-methylpyrazol-1-yl)ethyl]-4-(thian-4-yl)piperazine (PubChem CID 91839725) has the molecular formula C15H26N4S and a molecular weight of 294.47 g/mol. Its IUPAC name is 1-[2-(5-methylpyrazol-1-yl)ethyl]-4-(thian-4-yl)piperazine.
| Compound Name | 1-[2-(5-methylpyrazol-1-yl)ethyl]-4-(thian-4-yl)piperazine |
|---|---|
| PubChem CID | 91839725 |
| Molecular Formula | C15H26N4S |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 1-[2-(5-methylpyrazol-1-yl)ethyl]-4-(thian-4-yl)piperazine |
| SMILES | Cc1ccnn1CCN1CCN(C2CCSCC2)CC1 |
| InChI | InChI=1S/C15H26N4S/c1-14-2-5-16-19(14)11-8-17-6-9-18(10-7-17)15-3-12-20-13-4-15/h2,5,15H,3-4,6-13H2,1H3 |
| InChIKey | DNDUUSYYRJEREH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |