C17H30N4O2S — CID 133116101
(4aR,7aS)-4-(2-methylpropyl)-1-[(1-propylimidazol-2-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide (PubChem CID 133116101) has the molecular formula C17H30N4O2S and a molecular weight of 354.52 g/mol. Its IUPAC name is (4aR,7aS)-4-(2-methylpropyl)-1-[(1-propylimidazol-2-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide.
| Compound Name | (4aR,7aS)-4-(2-methylpropyl)-1-[(1-propylimidazol-2-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
|---|---|
| PubChem CID | 133116101 |
| Molecular Formula | C17H30N4O2S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | (4aR,7aS)-4-(2-methylpropyl)-1-[(1-propylimidazol-2-yl)methyl]-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine 6,6-dioxide |
| SMILES | CCCn1ccnc1CN1CCN(CC(C)C)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C17H30N4O2S/c1-4-6-19-7-5-18-17(19)11-21-9-8-20(10-14(2)3)15-12-24(22,23)13-16(15)21/h5,7,14-16H,4,6,8-13H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | RZSJHANPGDKHLK-JKSUJKDBSA-N |
| XLogP | 1.23 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |