C13H25N3 — CID 81016215
N,2,3-trimethyl-4-(1-propylimidazol-2-yl)butan-1-amine (PubChem CID 81016215) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is N,2,3-trimethyl-4-(1-propylimidazol-2-yl)butan-1-amine.
| Compound Name | N,2,3-trimethyl-4-(1-propylimidazol-2-yl)butan-1-amine |
|---|---|
| PubChem CID | 81016215 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | N,2,3-trimethyl-4-(1-propylimidazol-2-yl)butan-1-amine |
| SMILES | CCCn1ccnc1CC(C)C(C)CNC |
| InChI | InChI=1S/C13H25N3/c1-5-7-16-8-6-15-13(16)9-11(2)12(3)10-14-4/h6,8,11-12,14H,5,7,9-10H2,1-4H3 |
| InChIKey | NMZIHECVMYTKPY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |