C10H19N3 — CID 64666437
3-(1-ethylimidazol-2-yl)-N,2-dimethylpropan-1-amine (PubChem CID 64666437) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is 3-(1-ethylimidazol-2-yl)-N,2-dimethylpropan-1-amine.
| Compound Name | 3-(1-ethylimidazol-2-yl)-N,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 64666437 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 3-(1-ethylimidazol-2-yl)-N,2-dimethylpropan-1-amine |
| SMILES | CCn1ccnc1CC(C)CNC |
| InChI | InChI=1S/C10H19N3/c1-4-13-6-5-12-10(13)7-9(2)8-11-3/h5-6,9,11H,4,7-8H2,1-3H3 |
| InChIKey | DSWFJMZGQTXRAF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |