C12H24N4 — CID 105321751
[3-ethyl-1-(1-ethylimidazol-2-yl)pentan-2-yl]hydrazine (PubChem CID 105321751) has the molecular formula C12H24N4 and a molecular weight of 224.35 g/mol. Its IUPAC name is [3-ethyl-1-(1-ethylimidazol-2-yl)pentan-2-yl]hydrazine.
| Compound Name | [3-ethyl-1-(1-ethylimidazol-2-yl)pentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105321751 |
| Molecular Formula | C12H24N4 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | [3-ethyl-1-(1-ethylimidazol-2-yl)pentan-2-yl]hydrazine |
| SMILES | CCC(CC)C(Cc1nccn1CC)NN |
| InChI | InChI=1S/C12H24N4/c1-4-10(5-2)11(15-13)9-12-14-7-8-16(12)6-3/h7-8,10-11,15H,4-6,9,13H2,1-3H3 |
| InChIKey | DBWLZVRRIRRBGO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|