C12H24N4S — CID 105226247
[1-propan-2-ylsulfanyl-3-(1-propylimidazol-2-yl)propan-2-yl]hydrazine (PubChem CID 105226247) has the molecular formula C12H24N4S and a molecular weight of 256.42 g/mol. Its IUPAC name is [1-propan-2-ylsulfanyl-3-(1-propylimidazol-2-yl)propan-2-yl]hydrazine.
| Compound Name | [1-propan-2-ylsulfanyl-3-(1-propylimidazol-2-yl)propan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105226247 |
| Molecular Formula | C12H24N4S |
| Molecular Weight | 256.42 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | [1-propan-2-ylsulfanyl-3-(1-propylimidazol-2-yl)propan-2-yl]hydrazine |
| SMILES | CCCn1ccnc1CC(CSC(C)C)NN |
| InChI | InChI=1S/C12H24N4S/c1-4-6-16-7-5-14-12(16)8-11(15-13)9-17-10(2)3/h5,7,10-11,15H,4,6,8-9,13H2,1-3H3 |
| InChIKey | DTIZFSLMNFFNBI-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|