C13H25N3O2 — CID 79760794
1,1-diethoxy-3-(1-propylimidazol-2-yl)propan-2-amine (PubChem CID 79760794) has the molecular formula C13H25N3O2 and a molecular weight of 255.36 g/mol. Its IUPAC name is 1,1-diethoxy-3-(1-propylimidazol-2-yl)propan-2-amine.
| Compound Name | 1,1-diethoxy-3-(1-propylimidazol-2-yl)propan-2-amine |
|---|---|
| PubChem CID | 79760794 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | 1,1-diethoxy-3-(1-propylimidazol-2-yl)propan-2-amine |
| SMILES | CCCn1ccnc1CC(N)C(OCC)OCC |
| InChI | InChI=1S/C13H25N3O2/c1-4-8-16-9-7-15-12(16)10-11(14)13(17-5-2)18-6-3/h7,9,11,13H,4-6,8,10,14H2,1-3H3 |
| InChIKey | SCFBLTMFHZKBNT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|