C10H16N2O3 — CID 79744437
methyl 2-hydroxy-3-(1-propylimidazol-2-yl)propanoate (PubChem CID 79744437) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is methyl 2-hydroxy-3-(1-propylimidazol-2-yl)propanoate.
| Compound Name | methyl 2-hydroxy-3-(1-propylimidazol-2-yl)propanoate |
|---|---|
| PubChem CID | 79744437 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | methyl 2-hydroxy-3-(1-propylimidazol-2-yl)propanoate |
| SMILES | CCCn1ccnc1CC(O)C(=O)OC |
| InChI | InChI=1S/C10H16N2O3/c1-3-5-12-6-4-11-9(12)7-8(13)10(14)15-2/h4,6,8,13H,3,5,7H2,1-2H3 |
| InChIKey | RKDVIIONLLGBIE-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |