C18H26N2O4S — CID 70766062
4-[[(4aS,7aR)-4-(2-methylpropyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]methyl]benzoic acid (PubChem CID 70766062) has the molecular formula C18H26N2O4S and a molecular weight of 366.48 g/mol. Its IUPAC name is 4-[[(4aS,7aR)-4-(2-methylpropyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[(4aS,7aR)-4-(2-methylpropyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 70766062 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 4-[[(4aS,7aR)-4-(2-methylpropyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]methyl]benzoic acid |
| SMILES | CC(C)CN1CCN(Cc2ccc(C(=O)O)cc2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C18H26N2O4S/c1-13(2)9-19-7-8-20(17-12-25(23,24)11-16(17)19)10-14-3-5-15(6-4-14)18(21)22/h3-6,13,16-17H,7-12H2,1-2H3,(H,21,22)/t16-,17+/m1/s1 |
| InChIKey | DDPHWJBSUDUQJN-SJORKVTESA-N |
| XLogP | 1.32 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |