C18H23N3O3S — CID 70733057
4-[(4aR,7aS)-1-(2-methylpropyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]benzonitrile (PubChem CID 70733057) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is 4-[(4aR,7aS)-1-(2-methylpropyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]benzonitrile.
| Compound Name | 4-[(4aR,7aS)-1-(2-methylpropyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 70733057 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 4-[(4aR,7aS)-1-(2-methylpropyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]benzonitrile |
| SMILES | CC(C)CN1CCN(C(=O)c2ccc(C#N)cc2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C18H23N3O3S/c1-13(2)10-20-7-8-21(17-12-25(23,24)11-16(17)20)18(22)15-5-3-14(9-19)4-6-15/h3-6,13,16-17H,7-8,10-12H2,1-2H3/t16-,17+/m1/s1 |
| InChIKey | RKKAMDUWGUFEQS-SJORKVTESA-N |
| XLogP | 1.14 |
| TPSA | 81.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |