C17H22N4O4S — CID 133121361
7-[(4aS,7aR)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-3,4-dihydro-1H-quinoxalin-2-one (PubChem CID 133121361) has the molecular formula C17H22N4O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is 7-[(4aS,7aR)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-3,4-dihydro-1H-quinoxalin-2-one.
| Compound Name | 7-[(4aS,7aR)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-3,4-dihydro-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 133121361 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 7-[(4aS,7aR)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-3,4-dihydro-1H-quinoxalin-2-one |
| SMILES | CCN1CCN(C(=O)c2ccc3c(c2)NC(=O)CN3)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C17H22N4O4S/c1-2-20-5-6-21(15-10-26(24,25)9-14(15)20)17(23)11-3-4-12-13(7-11)19-16(22)8-18-12/h3-4,7,14-15,18H,2,5-6,8-10H2,1H3,(H,19,22)/t14-,15+/m0/s1 |
| InChIKey | BOIUSUZHNKPMKW-LSDHHAIUSA-N |
| XLogP | -0.01 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |