C18H21N3O4S — CID 133121834
4-[(4aS,7aR)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-2H-isoquinolin-1-one (PubChem CID 133121834) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is 4-[(4aS,7aR)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-2H-isoquinolin-1-one.
| Compound Name | 4-[(4aS,7aR)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 133121834 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 4-[(4aS,7aR)-1-ethyl-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-2H-isoquinolin-1-one |
| SMILES | CCN1CCN(C(=O)c2c[nH]c(=O)c3ccccc23)[C@@H]2CS(=O)(=O)C[C@@H]21 |
| InChI | InChI=1S/C18H21N3O4S/c1-2-20-7-8-21(16-11-26(24,25)10-15(16)20)18(23)14-9-19-17(22)13-6-4-3-5-12(13)14/h3-6,9,15-16H,2,7-8,10-11H2,1H3,(H,19,22)/t15-,16+/m0/s1 |
| InChIKey | BDWXSXMCYQTVNP-JKSUJKDBSA-N |
| XLogP | 0.47 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |