C16H21N3O5S — CID 70780776
5-[(4aR,7aS)-6,6-dioxo-1-propanoyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-2-methyl-1H-pyridin-4-one (PubChem CID 70780776) has the molecular formula C16H21N3O5S and a molecular weight of 367.43 g/mol. Its IUPAC name is 5-[(4aR,7aS)-6,6-dioxo-1-propanoyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-2-methyl-1H-pyridin-4-one.
| Compound Name | 5-[(4aR,7aS)-6,6-dioxo-1-propanoyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-2-methyl-1H-pyridin-4-one |
|---|---|
| PubChem CID | 70780776 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 5-[(4aR,7aS)-6,6-dioxo-1-propanoyl-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazine-4-carbonyl]-2-methyl-1H-pyridin-4-one |
| SMILES | CCC(=O)N1CCN(C(=O)c2c[nH]c(C)cc2=O)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C16H21N3O5S/c1-3-15(21)18-4-5-19(13-9-25(23,24)8-12(13)18)16(22)11-7-17-10(2)6-14(11)20/h6-7,12-13H,3-5,8-9H2,1-2H3,(H,17,20)/t12-,13+/m1/s1 |
| InChIKey | CHJPTKQDNCRFFD-OLZOCXBDSA-N |
| XLogP | -0.46 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |