C17H24N2O4S2 — CID 70716407
1-[(4aR,7aS)-6,6-dioxo-4-(5-propylthiophene-3-carbonyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]propan-1-one (PubChem CID 70716407) has the molecular formula C17H24N2O4S2 and a molecular weight of 384.52 g/mol. Its IUPAC name is 1-[(4aR,7aS)-6,6-dioxo-4-(5-propylthiophene-3-carbonyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]propan-1-one.
| Compound Name | 1-[(4aR,7aS)-6,6-dioxo-4-(5-propylthiophene-3-carbonyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 70716407 |
| Molecular Formula | C17H24N2O4S2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 1-[(4aR,7aS)-6,6-dioxo-4-(5-propylthiophene-3-carbonyl)-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-1-yl]propan-1-one |
| SMILES | CCCc1cc(C(=O)N2CCN(C(=O)CC)[C@@H]3CS(=O)(=O)C[C@@H]32)cs1 |
| InChI | InChI=1S/C17H24N2O4S2/c1-3-5-13-8-12(9-24-13)17(21)19-7-6-18(16(20)4-2)14-10-25(22,23)11-15(14)19/h8-9,14-15H,3-7,10-11H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | FSCKGWMFSVUQON-CABCVRRESA-N |
| XLogP | 1.56 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |