C17H24N2O3S2 — CID 70784042
[(4aR,7aS)-1-(cyclopropylmethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(5-ethylthiophen-3-yl)methanone (PubChem CID 70784042) has the molecular formula C17H24N2O3S2 and a molecular weight of 368.52 g/mol. Its IUPAC name is [(4aR,7aS)-1-(cyclopropylmethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(5-ethylthiophen-3-yl)methanone.
| Compound Name | [(4aR,7aS)-1-(cyclopropylmethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(5-ethylthiophen-3-yl)methanone |
|---|---|
| PubChem CID | 70784042 |
| Molecular Formula | C17H24N2O3S2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | [(4aR,7aS)-1-(cyclopropylmethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(5-ethylthiophen-3-yl)methanone |
| SMILES | CCc1cc(C(=O)N2CCN(CC3CC3)[C@@H]3CS(=O)(=O)C[C@@H]32)cs1 |
| InChI | InChI=1S/C17H24N2O3S2/c1-2-14-7-13(9-23-14)17(20)19-6-5-18(8-12-3-4-12)15-10-24(21,22)11-16(15)19/h7,9,12,15-16H,2-6,8,10-11H2,1H3/t15-,16+/m1/s1 |
| InChIKey | KRTRJDYGSYLYDE-CVEARBPZSA-N |
| XLogP | 1.64 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |