C17H25N3O4S — CID 70786602
[(4aR,7aS)-1-(cyclopropylmethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(3-propan-2-yl-1,2-oxazol-5-yl)methanone (PubChem CID 70786602) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is [(4aR,7aS)-1-(cyclopropylmethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(3-propan-2-yl-1,2-oxazol-5-yl)methanone.
| Compound Name | [(4aR,7aS)-1-(cyclopropylmethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(3-propan-2-yl-1,2-oxazol-5-yl)methanone |
|---|---|
| PubChem CID | 70786602 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | [(4aR,7aS)-1-(cyclopropylmethyl)-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-(3-propan-2-yl-1,2-oxazol-5-yl)methanone |
| SMILES | CC(C)c1cc(C(=O)N2CCN(CC3CC3)[C@@H]3CS(=O)(=O)C[C@@H]32)on1 |
| InChI | InChI=1S/C17H25N3O4S/c1-11(2)13-7-16(24-18-13)17(21)20-6-5-19(8-12-3-4-12)14-9-25(22,23)10-15(14)20/h7,11-12,14-15H,3-6,8-10H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | IRORBJGBBOOPAJ-CABCVRRESA-N |
| XLogP | 1.13 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |