C19H29NOS — CID 42643881
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(5-pentylthiophen-3-yl)methanone (PubChem CID 42643881) has the molecular formula C19H29NOS and a molecular weight of 319.51 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(5-pentylthiophen-3-yl)methanone.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(5-pentylthiophen-3-yl)methanone |
|---|---|
| PubChem CID | 42643881 |
| Molecular Formula | C19H29NOS |
| Molecular Weight | 319.51 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(5-pentylthiophen-3-yl)methanone |
| SMILES | CCCCCc1cc(C(=O)N2CCCC3CCCCC32)cs1 |
| InChI | InChI=1S/C19H29NOS/c1-2-3-4-10-17-13-16(14-22-17)19(21)20-12-7-9-15-8-5-6-11-18(15)20/h13-15,18H,2-12H2,1H3 |
| InChIKey | BWQLSCQESNOLTG-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|