C24H36N2O3S — CID 42646242
1-[4-[4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl)thiophen-2-yl]piperidin-1-yl]-4-methoxybutan-1-one (PubChem CID 42646242) has the molecular formula C24H36N2O3S and a molecular weight of 432.63 g/mol. Its IUPAC name is 1-[4-[4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl)thiophen-2-yl]piperidin-1-yl]-4-methoxybutan-1-one.
| Compound Name | 1-[4-[4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl)thiophen-2-yl]piperidin-1-yl]-4-methoxybutan-1-one |
|---|---|
| PubChem CID | 42646242 |
| Molecular Formula | C24H36N2O3S |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | 1-[4-[4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl)thiophen-2-yl]piperidin-1-yl]-4-methoxybutan-1-one |
| SMILES | COCCCC(=O)N1CCC(c2cc(C(=O)N3CCCC4CCCCC43)cs2)CC1 |
| InChI | InChI=1S/C24H36N2O3S/c1-29-15-5-9-23(27)25-13-10-19(11-14-25)22-16-20(17-30-22)24(28)26-12-4-7-18-6-2-3-8-21(18)26/h16-19,21H,2-15H2,1H3 |
| InChIKey | BOLQXPBNBVKJKE-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|