C19H27NOS2 — CID 68789274
[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[5-(thian-4-yl)thiophen-3-yl]methanone (PubChem CID 68789274) has the molecular formula C19H27NOS2 and a molecular weight of 349.57 g/mol. Its IUPAC name is [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[5-(thian-4-yl)thiophen-3-yl]methanone.
| Compound Name | [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[5-(thian-4-yl)thiophen-3-yl]methanone |
|---|---|
| PubChem CID | 68789274 |
| Molecular Formula | C19H27NOS2 |
| Molecular Weight | 349.57 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[5-(thian-4-yl)thiophen-3-yl]methanone |
| SMILES | O=C(c1csc(C2CCSCC2)c1)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C19H27NOS2/c21-19(20-9-3-5-14-4-1-2-6-17(14)20)16-12-18(23-13-16)15-7-10-22-11-8-15/h12-15,17H,1-11H2/t14-,17-/m1/s1 |
| InChIKey | MVGVOJQZWGTEBN-RHSMWYFYSA-N |
| XLogP | 5.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.57 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |