C24H34N4OS — CID 59542540
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-[1-[(1-methylpyrazol-4-yl)methyl]piperidin-4-yl]thiophen-3-yl]methanone (PubChem CID 59542540) has the molecular formula C24H34N4OS and a molecular weight of 426.63 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-[1-[(1-methylpyrazol-4-yl)methyl]piperidin-4-yl]thiophen-3-yl]methanone.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-[1-[(1-methylpyrazol-4-yl)methyl]piperidin-4-yl]thiophen-3-yl]methanone |
|---|---|
| PubChem CID | 59542540 |
| Molecular Formula | C24H34N4OS |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-[1-[(1-methylpyrazol-4-yl)methyl]piperidin-4-yl]thiophen-3-yl]methanone |
| SMILES | Cn1cc(CN2CCC(c3cc(C(=O)N4CCCC5CCCCC54)cs3)CC2)cn1 |
| InChI | InChI=1S/C24H34N4OS/c1-26-15-18(14-25-26)16-27-11-8-20(9-12-27)23-13-21(17-30-23)24(29)28-10-4-6-19-5-2-3-7-22(19)28/h13-15,17,19-20,22H,2-12,16H2,1H3 |
| InChIKey | JNFFYALFEZAAEK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |