C18H26N2OS — CID 59542536
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(5-pyrrolidin-3-ylthiophen-3-yl)methanone (PubChem CID 59542536) has the molecular formula C18H26N2OS and a molecular weight of 318.49 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(5-pyrrolidin-3-ylthiophen-3-yl)methanone.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(5-pyrrolidin-3-ylthiophen-3-yl)methanone |
|---|---|
| PubChem CID | 59542536 |
| Molecular Formula | C18H26N2OS |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(5-pyrrolidin-3-ylthiophen-3-yl)methanone |
| SMILES | O=C(c1csc(C2CCNC2)c1)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C18H26N2OS/c21-18(15-10-17(22-12-15)14-7-8-19-11-14)20-9-3-5-13-4-1-2-6-16(13)20/h10,12-14,16,19H,1-9,11H2 |
| InChIKey | JVSJQKAKXXNCFI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |