C23H36N2O3S2 — CID 59542568
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-[1-(2-methylpropylsulfonyl)piperidin-4-yl]thiophen-3-yl]methanone (PubChem CID 59542568) has the molecular formula C23H36N2O3S2 and a molecular weight of 452.69 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-[1-(2-methylpropylsulfonyl)piperidin-4-yl]thiophen-3-yl]methanone.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-[1-(2-methylpropylsulfonyl)piperidin-4-yl]thiophen-3-yl]methanone |
|---|---|
| PubChem CID | 59542568 |
| Molecular Formula | C23H36N2O3S2 |
| Molecular Weight | 452.69 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[5-[1-(2-methylpropylsulfonyl)piperidin-4-yl]thiophen-3-yl]methanone |
| SMILES | CC(C)CS(=O)(=O)N1CCC(c2cc(C(=O)N3CCCC4CCCCC43)cs2)CC1 |
| InChI | InChI=1S/C23H36N2O3S2/c1-17(2)16-30(27,28)24-12-9-19(10-13-24)22-14-20(15-29-22)23(26)25-11-5-7-18-6-3-4-8-21(18)25/h14-15,17-19,21H,3-13,16H2,1-2H3 |
| InChIKey | VREARYZSFVTLDF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.69 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |